About N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;heptane
N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;heptane (PubChem CID 175509277) has the molecular formula C13H34N3OP
and a molecular weight of 279.41 g/mol. Its IUPAC name is N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;heptane.
Molecular Properties
| Compound Name | N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;heptane |
| PubChem CID | 175509277 |
| Molecular Formula | C13H34N3OP |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;heptane |
| SMILES | CCCCCCC.CN(C)P(=O)(N(C)C)N(C)C |
| InChI | InChI=1S/C7H16.C6H18N3OP/c1-3-5-7-6-4-2;1-7(2)11(10,8(3)4)9(5)6/h3-7H2,1-2H3;1-6H3 |
| InChIKey | GJRXADSMDCCEFZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;heptane?
The IUPAC name of N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;heptane (CID 175509277) is N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;heptane.
What is the SMILES notation for N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;heptane?
The canonical SMILES for N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;heptane is CCCCCCC.CN(C)P(=O)(N(C)C)N(C)C.
What is the InChIKey of N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;heptane?
The InChIKey is GJRXADSMDCCEFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16.C6H18N3OP/c1-3-5-7-6-4-2;1-7(2)11(10,8(3)4)9(5)6/h3-7H2,1-2H3;1-6H3.
What are the key properties of N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;heptane?
N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;heptane has a molecular weight of 279.41 g/mol, XLogP of 3.76, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine;heptane is sourced from PubChem (CID 175509277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).