About bis(N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine);dibromo(dibutyl)stannane
bis(N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine);dibromo(dibutyl)stannane (PubChem CID 134905059) has the molecular formula C20H54Br2N6O2P2Sn
and a molecular weight of 751.16 g/mol. Its IUPAC name is bis(N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine);dibromo(dibutyl)stannane.
Molecular Properties
| Compound Name | bis(N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine);dibromo(dibutyl)stannane |
| PubChem CID | 134905059 |
| Molecular Formula | C20H54Br2N6O2P2Sn |
| Molecular Weight | 751.16 g/mol |
| Exact Mass | 750.12 |
| IUPAC Name | bis(N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine);dibromo(dibutyl)stannane |
| SMILES | CCCC[Sn](Br)(Br)CCCC.CN(C)P(=O)(N(C)C)N(C)C.CN(C)P(=O)(N(C)C)N(C)C |
| InChI | InChI=1S/2C6H18N3OP.2C4H9.2BrH.Sn/c2*1-7(2)11(10,8(3)4)9(5)6;2*1-3-4-2;;;/h2*1-6H3;2*1,3-4H2,2H3;2*1H;/q;;;;;;+2/p-2 |
| InChIKey | DIIKXSMORXOACG-UHFFFAOYSA-L |
| XLogP | 6.38 |
| TPSA | 53.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 751.16 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine);dibromo(dibutyl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine);dibromo(dibutyl)stannane?
The IUPAC name of bis(N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine);dibromo(dibutyl)stannane (CID 134905059) is bis(N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine);dibromo(dibutyl)stannane.
What is the SMILES notation for bis(N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine);dibromo(dibutyl)stannane?
The canonical SMILES for bis(N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine);dibromo(dibutyl)stannane is CCCC[Sn](Br)(Br)CCCC.CN(C)P(=O)(N(C)C)N(C)C.CN(C)P(=O)(N(C)C)N(C)C.
What is the InChIKey of bis(N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine);dibromo(dibutyl)stannane?
The InChIKey is DIIKXSMORXOACG-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H18N3OP.2C4H9.2BrH.Sn/c2*1-7(2)11(10,8(3)4)9(5)6;2*1-3-4-2;;;/h2*1-6H3;2*1,3-4H2,2H3;2*1H;/q;;;;;;+2/p-2.
What are the key properties of bis(N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine);dibromo(dibutyl)stannane?
bis(N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine);dibromo(dibutyl)stannane has a molecular weight of 751.16 g/mol, XLogP of 6.38, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-[bis(dimethylamino)phosphoryl]-N-methylmethanamine);dibromo(dibutyl)stannane is sourced from PubChem (CID 134905059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).