About dibromo(dibutyl)stannane;dibromo(dimethyl)stannane
dibromo(dibutyl)stannane;dibromo(dimethyl)stannane (PubChem CID 88779417) has the molecular formula C10H24Br4Sn2
and a molecular weight of 701.34 g/mol. Its IUPAC name is dibromo(dibutyl)stannane;dibromo(dimethyl)stannane.
Molecular Properties
| Compound Name | dibromo(dibutyl)stannane;dibromo(dimethyl)stannane |
| PubChem CID | 88779417 |
| Molecular Formula | C10H24Br4Sn2 |
| Molecular Weight | 701.34 g/mol |
| Exact Mass | 699.67 |
| IUPAC Name | dibromo(dibutyl)stannane;dibromo(dimethyl)stannane |
| SMILES | CCCC[Sn](Br)(Br)CCCC.C[Sn](C)(Br)Br |
| InChI | InChI=1S/2C4H9.2CH3.4BrH.2Sn/c2*1-3-4-2;;;;;;;;/h2*1,3-4H2,2H3;2*1H3;4*1H;;/q;;;;;;;;2*+2/p-4 |
| InChIKey | DVDFTVCNIAHJQN-UHFFFAOYSA-J |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 701.34 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dibromo(dibutyl)stannane;dibromo(dimethyl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromo(dibutyl)stannane;dibromo(dimethyl)stannane?
The IUPAC name of dibromo(dibutyl)stannane;dibromo(dimethyl)stannane (CID 88779417) is dibromo(dibutyl)stannane;dibromo(dimethyl)stannane.
What is the SMILES notation for dibromo(dibutyl)stannane;dibromo(dimethyl)stannane?
The canonical SMILES for dibromo(dibutyl)stannane;dibromo(dimethyl)stannane is CCCC[Sn](Br)(Br)CCCC.C[Sn](C)(Br)Br.
What is the InChIKey of dibromo(dibutyl)stannane;dibromo(dimethyl)stannane?
The InChIKey is DVDFTVCNIAHJQN-UHFFFAOYSA-J. The full InChI is InChI=1S/2C4H9.2CH3.4BrH.2Sn/c2*1-3-4-2;;;;;;;;/h2*1,3-4H2,2H3;2*1H3;4*1H;;/q;;;;;;;;2*+2/p-4.
What are the key properties of dibromo(dibutyl)stannane;dibromo(dimethyl)stannane?
dibromo(dibutyl)stannane;dibromo(dimethyl)stannane has a molecular weight of 701.34 g/mol, XLogP of 7.30, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibromo(dibutyl)stannane;dibromo(dimethyl)stannane is sourced from PubChem (CID 88779417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).