C24H32FN3O3S — CID 175513377
tert-butyl-[[(1S)-1-[4-[[4-(4-carboxypiperazin-1-yl)-3-fluorophenyl]methyl]phenyl]ethyl]amino]-oxidosulfanium (PubChem CID 175513377) has the molecular formula C24H32FN3O3S and a molecular weight of 461.60 g/mol. Its IUPAC name is tert-butyl-[[(1S)-1-[4-[[4-(4-carboxypiperazin-1-yl)-3-fluorophenyl]methyl]phenyl]ethyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1S)-1-[4-[[4-(4-carboxypiperazin-1-yl)-3-fluorophenyl]methyl]phenyl]ethyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175513377 |
| Molecular Formula | C24H32FN3O3S |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | tert-butyl-[[(1S)-1-[4-[[4-(4-carboxypiperazin-1-yl)-3-fluorophenyl]methyl]phenyl]ethyl]amino]-oxidosulfanium |
| SMILES | C[C@H](N[S+]([O-])C(C)(C)C)c1ccc(Cc2ccc(N3CCN(C(=O)O)CC3)c(F)c2)cc1 |
| InChI | InChI=1S/C24H32FN3O3S/c1-17(26-32(31)24(2,3)4)20-8-5-18(6-9-20)15-19-7-10-22(21(25)16-19)27-11-13-28(14-12-27)23(29)30/h5-10,16-17,26H,11-15H2,1-4H3,(H,29,30)/t17-,32?/m0/s1 |
| InChIKey | YCLMBLLDMMPYON-BKVVKPGQSA-N |
| XLogP | 4.33 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|