C24H30N4O7S — CID 175517153
formic acid;4-[(2R,4R)-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-4-(sulfamoylamino)piperidin-2-yl]benzoic acid (PubChem CID 175517153) has the molecular formula C24H30N4O7S and a molecular weight of 518.59 g/mol. Its IUPAC name is formic acid;4-[(2R,4R)-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-4-(sulfamoylamino)piperidin-2-yl]benzoic acid.
| Compound Name | formic acid;4-[(2R,4R)-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-4-(sulfamoylamino)piperidin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 175517153 |
| Molecular Formula | C24H30N4O7S |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | formic acid;4-[(2R,4R)-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-4-(sulfamoylamino)piperidin-2-yl]benzoic acid |
| SMILES | COc1cc(C)c2[nH]ccc2c1CN1CC[C@@H](NS(N)(=O)=O)C[C@@H]1c1ccc(C(=O)O)cc1.O=CO |
| InChI | InChI=1S/C23H28N4O5S.CH2O2/c1-14-11-21(32-2)19(18-7-9-25-22(14)18)13-27-10-8-17(26-33(24,30)31)12-20(27)15-3-5-16(6-4-15)23(28)29;2-1-3/h3-7,9,11,17,20,25-26H,8,10,12-13H2,1-2H3,(H,28,29)(H2,24,30,31);1H,(H,2,3)/t17-,20-;/m1./s1 |
| InChIKey | LCIDBKYAGDZEEO-OGPPPPIKSA-N |
| XLogP | 2.38 |
| TPSA | 175.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|