C19H26N2O4 — CID 175521555
(3,4-dicyclohexyl-2-nitrophenyl)carbamic acid (PubChem CID 175521555) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is (3,4-dicyclohexyl-2-nitrophenyl)carbamic acid.
| Compound Name | (3,4-dicyclohexyl-2-nitrophenyl)carbamic acid |
|---|---|
| PubChem CID | 175521555 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (3,4-dicyclohexyl-2-nitrophenyl)carbamic acid |
| SMILES | O=C(O)Nc1ccc(C2CCCCC2)c(C2CCCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H26N2O4/c22-19(23)20-16-12-11-15(13-7-3-1-4-8-13)17(18(16)21(24)25)14-9-5-2-6-10-14/h11-14,20H,1-10H2,(H,22,23) |
| InChIKey | YALHPEZSGLGLHT-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|