About 4-phosphorosooxyheptane
4-phosphorosooxyheptane (PubChem CID 175521666) has the molecular formula C7H15O2P
and a molecular weight of 162.17 g/mol. Its IUPAC name is 4-phosphorosooxyheptane.
Molecular Properties
| Compound Name | 4-phosphorosooxyheptane |
| PubChem CID | 175521666 |
| Molecular Formula | C7H15O2P |
| Molecular Weight | 162.17 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 4-phosphorosooxyheptane |
| SMILES | CCCC(CCC)OP=O |
| InChI | InChI=1S/C7H15O2P/c1-3-5-7(6-4-2)9-10-8/h7H,3-6H2,1-2H3 |
| InChIKey | FCYFWWUQTDDQTG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.17 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-phosphorosooxyheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phosphorosooxyheptane?
The IUPAC name of 4-phosphorosooxyheptane (CID 175521666) is 4-phosphorosooxyheptane.
What is the SMILES notation for 4-phosphorosooxyheptane?
The canonical SMILES for 4-phosphorosooxyheptane is CCCC(CCC)OP=O.
What is the InChIKey of 4-phosphorosooxyheptane?
The InChIKey is FCYFWWUQTDDQTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15O2P/c1-3-5-7(6-4-2)9-10-8/h7H,3-6H2,1-2H3.
What are the key properties of 4-phosphorosooxyheptane?
4-phosphorosooxyheptane has a molecular weight of 162.17 g/mol, XLogP of 3.18, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phosphorosooxyheptane is sourced from PubChem (CID 175521666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).