C4H9O4P — CID 174758189
2-phosphorosooxybutane-1,4-diol (PubChem CID 174758189) has the molecular formula C4H9O4P and a molecular weight of 152.09 g/mol. Its IUPAC name is 2-phosphorosooxybutane-1,4-diol.
| Compound Name | 2-phosphorosooxybutane-1,4-diol |
|---|---|
| PubChem CID | 174758189 |
| Molecular Formula | C4H9O4P |
| Molecular Weight | 152.09 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 2-phosphorosooxybutane-1,4-diol |
| SMILES | O=POC(CO)CCO |
| InChI | InChI=1S/C4H9O4P/c5-2-1-4(3-6)8-9-7/h4-6H,1-3H2 |
| InChIKey | GXOWOUBSTCOLGP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.09 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|