About 2-phosphorosooxybutane-1,4-diol
2-phosphorosooxybutane-1,4-diol (PubChem CID 174758189) has the molecular formula C4H9O4P
and a molecular weight of 152.09 g/mol. Its IUPAC name is 2-phosphorosooxybutane-1,4-diol.
Molecular Properties
| Compound Name | 2-phosphorosooxybutane-1,4-diol |
| PubChem CID | 174758189 |
| Molecular Formula | C4H9O4P |
| Molecular Weight | 152.09 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 2-phosphorosooxybutane-1,4-diol |
| SMILES | O=POC(CO)CCO |
| InChI | InChI=1S/C4H9O4P/c5-2-1-4(3-6)8-9-7/h4-6H,1-3H2 |
| InChIKey | GXOWOUBSTCOLGP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.09 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-phosphorosooxybutane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phosphorosooxybutane-1,4-diol?
The IUPAC name of 2-phosphorosooxybutane-1,4-diol (CID 174758189) is 2-phosphorosooxybutane-1,4-diol.
What is the SMILES notation for 2-phosphorosooxybutane-1,4-diol?
The canonical SMILES for 2-phosphorosooxybutane-1,4-diol is O=POC(CO)CCO.
What is the InChIKey of 2-phosphorosooxybutane-1,4-diol?
The InChIKey is GXOWOUBSTCOLGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O4P/c5-2-1-4(3-6)8-9-7/h4-6H,1-3H2.
What are the key properties of 2-phosphorosooxybutane-1,4-diol?
2-phosphorosooxybutane-1,4-diol has a molecular weight of 152.09 g/mol, XLogP of -0.05, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phosphorosooxybutane-1,4-diol is sourced from PubChem (CID 174758189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).