(4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid

C9H18N2O2 — CID 175521902

IUPAC(4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid
SMILESCN[C@@H]1CCN(C(=O)O)C(C)(C)C1
InChIInChI=1S/C9H18N2O2/c1-9(2)6-7(10-3)4-5-11(9)8(12)13/h7,10H,4-6H2,1-3H3,(H,12,13)/t7-/m1/s1
InChIKeyXAVKMECKKORDSZ-SSDOTTSWSA-N
MW186.25 g/mol
LogP1.13
Rot. Bonds1

About (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid

(4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid (PubChem CID 175521902) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid.

Molecular Properties

Compound Name(4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid
PubChem CID175521902
Molecular FormulaC9H18N2O2
Molecular Weight186.25 g/mol
Exact Mass186.14
IUPAC Name(4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid
SMILESCN[C@@H]1CCN(C(=O)O)C(C)(C)C1
InChIInChI=1S/C9H18N2O2/c1-9(2)6-7(10-3)4-5-11(9)8(12)13/h7,10H,4-6H2,1-3H3,(H,12,13)/t7-/m1/s1
InChIKeyXAVKMECKKORDSZ-SSDOTTSWSA-N
XLogP1.13
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.25
LogP ≤ 51.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid?
The IUPAC name of (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid (CID 175521902) is (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid.
What is the SMILES notation for (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid?
The canonical SMILES for (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid is CN[C@@H]1CCN(C(=O)O)C(C)(C)C1.
What is the InChIKey of (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid?
The InChIKey is XAVKMECKKORDSZ-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-9(2)6-7(10-3)4-5-11(9)8(12)13/h7,10H,4-6H2,1-3H3,(H,12,13)/t7-/m1/s1.
What are the key properties of (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid?
(4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid has a molecular weight of 186.25 g/mol, XLogP of 1.13, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid is sourced from PubChem (CID 175521902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).