About (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid
(4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid (PubChem CID 175521902) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid.
Analyze (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid?
The IUPAC name of (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid (CID 175521902) is (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid.
What is the SMILES notation for (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid?
The canonical SMILES for (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid is CN[C@@H]1CCN(C(=O)O)C(C)(C)C1.
What is the InChIKey of (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid?
The InChIKey is XAVKMECKKORDSZ-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-9(2)6-7(10-3)4-5-11(9)8(12)13/h7,10H,4-6H2,1-3H3,(H,12,13)/t7-/m1/s1.
What are the key properties of (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid?
(4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid has a molecular weight of 186.25 g/mol, XLogP of 1.13, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,2-dimethyl-4-(methylamino)piperidine-1-carboxylic acid is sourced from PubChem (CID 175521902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).