(2S)-4-acetyl-2,6-dimethylpiperazine-1-carboxylic acid

C9H16N2O3 — CID 175521904

IUPAC(2S)-4-acetyl-2,6-dimethylpiperazine-1-carboxylic acid
SMILESCC(=O)N1CC(C)N(C(=O)O)[C@@H](C)C1
InChIInChI=1S/C9H16N2O3/c1-6-4-10(8(3)12)5-7(2)11(6)9(13)14/h6-7H,4-5H2,1-3H3,(H,13,14)/t6-,7?/m0/s1
InChIKeyAKWWERCZZZTZCN-PKPIPKONSA-N
MW200.24 g/mol
LogP0.61
Rot. Bonds

About (2S)-4-acetyl-2,6-dimethylpiperazine-1-carboxylic acid

(2S)-4-acetyl-2,6-dimethylpiperazine-1-carboxylic acid (PubChem CID 175521904) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is (2S)-4-acetyl-2,6-dimethylpiperazine-1-carboxylic acid.

Molecular Properties

Compound Name(2S)-4-acetyl-2,6-dimethylpiperazine-1-carboxylic acid
PubChem CID175521904
Molecular FormulaC9H16N2O3
Molecular Weight200.24 g/mol
Exact Mass200.12
IUPAC Name(2S)-4-acetyl-2,6-dimethylpiperazine-1-carboxylic acid
SMILESCC(=O)N1CC(C)N(C(=O)O)[C@@H](C)C1
InChIInChI=1S/C9H16N2O3/c1-6-4-10(8(3)12)5-7(2)11(6)9(13)14/h6-7H,4-5H2,1-3H3,(H,13,14)/t6-,7?/m0/s1
InChIKeyAKWWERCZZZTZCN-PKPIPKONSA-N
XLogP0.61
TPSA60.85 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.24
LogP ≤ 50.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (2S)-4-acetyl-2,6-dimethylpiperazine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-4-acetyl-2,6-dimethylpiperazine-1-carboxylic acid?
The IUPAC name of (2S)-4-acetyl-2,6-dimethylpiperazine-1-carboxylic acid (CID 175521904) is (2S)-4-acetyl-2,6-dimethylpiperazine-1-carboxylic acid.
What is the SMILES notation for (2S)-4-acetyl-2,6-dimethylpiperazine-1-carboxylic acid?
The canonical SMILES for (2S)-4-acetyl-2,6-dimethylpiperazine-1-carboxylic acid is CC(=O)N1CC(C)N(C(=O)O)[C@@H](C)C1.
What is the InChIKey of (2S)-4-acetyl-2,6-dimethylpiperazine-1-carboxylic acid?
The InChIKey is AKWWERCZZZTZCN-PKPIPKONSA-N. The full InChI is InChI=1S/C9H16N2O3/c1-6-4-10(8(3)12)5-7(2)11(6)9(13)14/h6-7H,4-5H2,1-3H3,(H,13,14)/t6-,7?/m0/s1.
What are the key properties of (2S)-4-acetyl-2,6-dimethylpiperazine-1-carboxylic acid?
(2S)-4-acetyl-2,6-dimethylpiperazine-1-carboxylic acid has a molecular weight of 200.24 g/mol, XLogP of 0.61, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-acetyl-2,6-dimethylpiperazine-1-carboxylic acid is sourced from PubChem (CID 175521904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).