C21H24F2N7O5S- — CID 175522412
4-[[4-(azidomethyl)-1-ethoxycarbonylpyrrolidin-3-yl]-sulfinatoamino]-3-fluoro-2-[(4-fluoro-3-methylphenyl)carbamoyl]-1-methylpyrrole (PubChem CID 175522412) has the molecular formula C21H24F2N7O5S- and a molecular weight of 524.53 g/mol. Its IUPAC name is 4-[[4-(azidomethyl)-1-ethoxycarbonylpyrrolidin-3-yl]-sulfinatoamino]-3-fluoro-2-[(4-fluoro-3-methylphenyl)carbamoyl]-1-methylpyrrole.
| Compound Name | 4-[[4-(azidomethyl)-1-ethoxycarbonylpyrrolidin-3-yl]-sulfinatoamino]-3-fluoro-2-[(4-fluoro-3-methylphenyl)carbamoyl]-1-methylpyrrole |
|---|---|
| PubChem CID | 175522412 |
| Molecular Formula | C21H24F2N7O5S- |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | 4-[[4-(azidomethyl)-1-ethoxycarbonylpyrrolidin-3-yl]-sulfinatoamino]-3-fluoro-2-[(4-fluoro-3-methylphenyl)carbamoyl]-1-methylpyrrole |
| SMILES | CCOC(=O)N1CC(CN=[N+]=[N-])C(N(c2cn(C)c(C(=O)Nc3ccc(F)c(C)c3)c2F)S(=O)[O-])C1 |
| InChI | InChI=1S/C21H25F2N7O5S/c1-4-35-21(32)29-9-13(8-25-27-24)16(11-29)30(36(33)34)17-10-28(3)19(18(17)23)20(31)26-14-5-6-15(22)12(2)7-14/h5-7,10,13,16H,4,8-9,11H2,1-3H3,(H,26,31)(H,33,34)/p-1 |
| InChIKey | IMAPKKUXEGNMOD-UHFFFAOYSA-M |
| XLogP | 3.23 |
| TPSA | 155.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|