C12H14ClF3N2 — CID 175523140
1-(4-chlorophenyl)-4-(1,2,2-trifluoroethyl)piperazine (PubChem CID 175523140) has the molecular formula C12H14ClF3N2 and a molecular weight of 278.71 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-(1,2,2-trifluoroethyl)piperazine.
| Compound Name | 1-(4-chlorophenyl)-4-(1,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 175523140 |
| Molecular Formula | C12H14ClF3N2 |
| Molecular Weight | 278.71 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 1-(4-chlorophenyl)-4-(1,2,2-trifluoroethyl)piperazine |
| SMILES | FC(F)C(F)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C12H14ClF3N2/c13-9-1-3-10(4-2-9)17-5-7-18(8-6-17)12(16)11(14)15/h1-4,11-12H,5-8H2 |
| InChIKey | NREITIYWUZVETR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.71 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|