About formamido 2-methylpyridine-4-carboxylate
formamido 2-methylpyridine-4-carboxylate (PubChem CID 175524966) has the molecular formula C8H8N2O3
and a molecular weight of 180.16 g/mol. Its IUPAC name is formamido 2-methylpyridine-4-carboxylate.
Molecular Properties
| Compound Name | formamido 2-methylpyridine-4-carboxylate |
| PubChem CID | 175524966 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | formamido 2-methylpyridine-4-carboxylate |
| SMILES | Cc1cc(C(=O)ONC=O)ccn1 |
| InChI | InChI=1S/C8H8N2O3/c1-6-4-7(2-3-9-6)8(12)13-10-5-11/h2-5H,1H3,(H,10,11) |
| InChIKey | PTIHZEQEIIQDPP-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formamido 2-methylpyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formamido 2-methylpyridine-4-carboxylate?
The IUPAC name of formamido 2-methylpyridine-4-carboxylate (CID 175524966) is formamido 2-methylpyridine-4-carboxylate.
What is the SMILES notation for formamido 2-methylpyridine-4-carboxylate?
The canonical SMILES for formamido 2-methylpyridine-4-carboxylate is Cc1cc(C(=O)ONC=O)ccn1.
What is the InChIKey of formamido 2-methylpyridine-4-carboxylate?
The InChIKey is PTIHZEQEIIQDPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3/c1-6-4-7(2-3-9-6)8(12)13-10-5-11/h2-5H,1H3,(H,10,11).
What are the key properties of formamido 2-methylpyridine-4-carboxylate?
formamido 2-methylpyridine-4-carboxylate has a molecular weight of 180.16 g/mol, XLogP of 0.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formamido 2-methylpyridine-4-carboxylate is sourced from PubChem (CID 175524966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).