C30H32N2O5 — CID 175525308
2,4-dimethoxy-6-[(E)-2-[4-[2-(2-oxopiperidin-1-yl)ethoxy]phenyl]ethenyl]-N-phenylbenzamide (PubChem CID 175525308) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is 2,4-dimethoxy-6-[(E)-2-[4-[2-(2-oxopiperidin-1-yl)ethoxy]phenyl]ethenyl]-N-phenylbenzamide.
| Compound Name | 2,4-dimethoxy-6-[(E)-2-[4-[2-(2-oxopiperidin-1-yl)ethoxy]phenyl]ethenyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 175525308 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 2,4-dimethoxy-6-[(E)-2-[4-[2-(2-oxopiperidin-1-yl)ethoxy]phenyl]ethenyl]-N-phenylbenzamide |
| SMILES | COc1cc(/C=C/c2ccc(OCCN3CCCCC3=O)cc2)c(C(=O)Nc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C30H32N2O5/c1-35-26-20-23(29(27(21-26)36-2)30(34)31-24-8-4-3-5-9-24)14-11-22-12-15-25(16-13-22)37-19-18-32-17-7-6-10-28(32)33/h3-5,8-9,11-16,20-21H,6-7,10,17-19H2,1-2H3,(H,31,34)/b14-11+ |
| InChIKey | ZLXLRUCTKDSZHZ-SDNWHVSQSA-N |
| XLogP | 5.52 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|