About bis(2-methylpropyl) hexanedioate;5-decoxycarbonylundecanoic acid
bis(2-methylpropyl) hexanedioate;5-decoxycarbonylundecanoic acid (PubChem CID 175526469) has the molecular formula C36H68O8
and a molecular weight of 628.93 g/mol. Its IUPAC name is bis(2-methylpropyl) hexanedioate;5-decoxycarbonylundecanoic acid.
Molecular Properties
| Compound Name | bis(2-methylpropyl) hexanedioate;5-decoxycarbonylundecanoic acid |
| PubChem CID | 175526469 |
| Molecular Formula | C36H68O8 |
| Molecular Weight | 628.93 g/mol |
| Exact Mass | 628.49 |
| IUPAC Name | bis(2-methylpropyl) hexanedioate;5-decoxycarbonylundecanoic acid |
| SMILES | CC(C)COC(=O)CCCCC(=O)OCC(C)C.CCCCCCCCCCOC(=O)C(CCCCCC)CCCC(=O)O |
| InChI | InChI=1S/C22H42O4.C14H26O4/c1-3-5-7-9-10-11-12-14-19-26-22(25)20(16-13-8-6-4-2)17-15-18-21(23)24;1-11(2)9-17-13(15)7-5-6-8-14(16)18-10-12(3)4/h20H,3-19H2,1-2H3,(H,23,24);11-12H,5-10H2,1-4H3 |
| InChIKey | OPOFEVWYYZFZBD-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 628.93 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylpropyl) hexanedioate;5-decoxycarbonylundecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylpropyl) hexanedioate;5-decoxycarbonylundecanoic acid?
The IUPAC name of bis(2-methylpropyl) hexanedioate;5-decoxycarbonylundecanoic acid (CID 175526469) is bis(2-methylpropyl) hexanedioate;5-decoxycarbonylundecanoic acid.
What is the SMILES notation for bis(2-methylpropyl) hexanedioate;5-decoxycarbonylundecanoic acid?
The canonical SMILES for bis(2-methylpropyl) hexanedioate;5-decoxycarbonylundecanoic acid is CC(C)COC(=O)CCCCC(=O)OCC(C)C.CCCCCCCCCCOC(=O)C(CCCCCC)CCCC(=O)O.
What is the InChIKey of bis(2-methylpropyl) hexanedioate;5-decoxycarbonylundecanoic acid?
The InChIKey is OPOFEVWYYZFZBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O4.C14H26O4/c1-3-5-7-9-10-11-12-14-19-26-22(25)20(16-13-8-6-4-2)17-15-18-21(23)24;1-11(2)9-17-13(15)7-5-6-8-14(16)18-10-12(3)4/h20H,3-19H2,1-2H3,(H,23,24);11-12H,5-10H2,1-4H3.
What are the key properties of bis(2-methylpropyl) hexanedioate;5-decoxycarbonylundecanoic acid?
bis(2-methylpropyl) hexanedioate;5-decoxycarbonylundecanoic acid has a molecular weight of 628.93 g/mol, XLogP of 9.46, 28 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpropyl) hexanedioate;5-decoxycarbonylundecanoic acid is sourced from PubChem (CID 175526469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).