C26H25FN4O2 — CID 175526644
12-(3-fluoro-5-methoxyphenyl)-5-(4-methylpiperazin-1-yl)-9-oxa-14,16-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,10,12,15-heptaene (PubChem CID 175526644) has the molecular formula C26H25FN4O2 and a molecular weight of 444.51 g/mol. Its IUPAC name is 12-(3-fluoro-5-methoxyphenyl)-5-(4-methylpiperazin-1-yl)-9-oxa-14,16-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,10,12,15-heptaene.
| Compound Name | 12-(3-fluoro-5-methoxyphenyl)-5-(4-methylpiperazin-1-yl)-9-oxa-14,16-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,10,12,15-heptaene |
|---|---|
| PubChem CID | 175526644 |
| Molecular Formula | C26H25FN4O2 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 12-(3-fluoro-5-methoxyphenyl)-5-(4-methylpiperazin-1-yl)-9-oxa-14,16-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,10,12,15-heptaene |
| SMILES | COc1cc(F)cc(-c2c[nH]c3ncc4c(c23)OCc2cc(N3CCN(C)CC3)ccc2-4)c1 |
| InChI | InChI=1S/C26H25FN4O2/c1-30-5-7-31(8-6-30)19-3-4-21-17(10-19)15-33-25-23(21)14-29-26-24(25)22(13-28-26)16-9-18(27)12-20(11-16)32-2/h3-4,9-14H,5-8,15H2,1-2H3,(H,28,29) |
| InChIKey | LSHCDCQHEIYCFK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 53.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |