C14H14Br2N2 — CID 175527496
1,1-bis[(2-bromophenyl)methyl]hydrazine (PubChem CID 175527496) has the molecular formula C14H14Br2N2 and a molecular weight of 370.09 g/mol. Its IUPAC name is 1,1-bis[(2-bromophenyl)methyl]hydrazine.
| Compound Name | 1,1-bis[(2-bromophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 175527496 |
| Molecular Formula | C14H14Br2N2 |
| Molecular Weight | 370.09 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | 1,1-bis[(2-bromophenyl)methyl]hydrazine |
| SMILES | NN(Cc1ccccc1Br)Cc1ccccc1Br |
| InChI | InChI=1S/C14H14Br2N2/c15-13-7-3-1-5-11(13)9-18(17)10-12-6-2-4-8-14(12)16/h1-8H,9-10,17H2 |
| InChIKey | IZMKMOKOVMMRFY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.09 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|