C25H22BrClN2O4 — CID 175531863
methyl 2-[4-bromo-2-[2-[5-[(6-chloro-2-pyridinyl)-hydroxymethyl]-2-cyanophenyl]ethoxymethyl]phenyl]acetate (PubChem CID 175531863) has the molecular formula C25H22BrClN2O4 and a molecular weight of 529.82 g/mol. Its IUPAC name is methyl 2-[4-bromo-2-[2-[5-[(6-chloro-2-pyridinyl)-hydroxymethyl]-2-cyanophenyl]ethoxymethyl]phenyl]acetate.
| Compound Name | methyl 2-[4-bromo-2-[2-[5-[(6-chloro-2-pyridinyl)-hydroxymethyl]-2-cyanophenyl]ethoxymethyl]phenyl]acetate |
|---|---|
| PubChem CID | 175531863 |
| Molecular Formula | C25H22BrClN2O4 |
| Molecular Weight | 529.82 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | methyl 2-[4-bromo-2-[2-[5-[(6-chloro-2-pyridinyl)-hydroxymethyl]-2-cyanophenyl]ethoxymethyl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(Br)cc1COCCc1cc(C(O)c2cccc(Cl)n2)ccc1C#N |
| InChI | InChI=1S/C25H22BrClN2O4/c1-32-24(30)13-16-7-8-21(26)12-20(16)15-33-10-9-17-11-18(5-6-19(17)14-28)25(31)22-3-2-4-23(27)29-22/h2-8,11-12,25,31H,9-10,13,15H2,1H3 |
| InChIKey | DJPODTHOJADQIA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 92.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.82 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|