C31H34BBrN2O6 — CID 166136455
methyl 2-[2-[2-[2-[(6-bromo-2-pyridinyl)oxymethyl]-5-cyanophenyl]ethoxymethyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate (PubChem CID 166136455) has the molecular formula C31H34BBrN2O6 and a molecular weight of 621.34 g/mol. Its IUPAC name is methyl 2-[2-[2-[2-[(6-bromo-2-pyridinyl)oxymethyl]-5-cyanophenyl]ethoxymethyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate.
| Compound Name | methyl 2-[2-[2-[2-[(6-bromo-2-pyridinyl)oxymethyl]-5-cyanophenyl]ethoxymethyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
|---|---|
| PubChem CID | 166136455 |
| Molecular Formula | C31H34BBrN2O6 |
| Molecular Weight | 621.34 g/mol |
| Exact Mass | 620.17 |
| IUPAC Name | methyl 2-[2-[2-[2-[(6-bromo-2-pyridinyl)oxymethyl]-5-cyanophenyl]ethoxymethyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1COCCc1cc(C#N)ccc1COc1cccc(Br)n1 |
| InChI | InChI=1S/C31H34BBrN2O6/c1-30(2)31(3,4)41-32(40-30)26-12-11-22(17-29(36)37-5)25(16-26)19-38-14-13-23-15-21(18-34)9-10-24(23)20-39-28-8-6-7-27(33)35-28/h6-12,15-16H,13-14,17,19-20H2,1-5H3 |
| InChIKey | VNYXQXXNUAEZEJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 99.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.34 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|