About methyl 2-[4-[[6-[(4-cyano-2-fluorophenyl)methoxy]-2-pyridinyl]oxy]-2,5-difluorophenyl]acetate
methyl 2-[4-[[6-[(4-cyano-2-fluorophenyl)methoxy]-2-pyridinyl]oxy]-2,5-difluorophenyl]acetate (PubChem CID 175522713) has the molecular formula C22H15F3N2O4
and a molecular weight of 428.37 g/mol. Its IUPAC name is methyl 2-[4-[[6-[(4-cyano-2-fluorophenyl)methoxy]-2-pyridinyl]oxy]-2,5-difluorophenyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[4-[[6-[(4-cyano-2-fluorophenyl)methoxy]-2-pyridinyl]oxy]-2,5-difluorophenyl]acetate |
| PubChem CID | 175522713 |
| Molecular Formula | C22H15F3N2O4 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | methyl 2-[4-[[6-[(4-cyano-2-fluorophenyl)methoxy]-2-pyridinyl]oxy]-2,5-difluorophenyl]acetate |
| SMILES | COC(=O)Cc1cc(F)c(Oc2cccc(OCc3ccc(C#N)cc3F)n2)cc1F |
| InChI | InChI=1S/C22H15F3N2O4/c1-29-22(28)9-15-8-18(25)19(10-17(15)24)31-21-4-2-3-20(27-21)30-12-14-6-5-13(11-26)7-16(14)23/h2-8,10H,9,12H2,1H3 |
| InChIKey | KGENEWJHPZUHAT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 81.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[4-[[6-[(4-cyano-2-fluorophenyl)methoxy]-2-pyridinyl]oxy]-2,5-difluorophenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-[[6-[(4-cyano-2-fluorophenyl)methoxy]-2-pyridinyl]oxy]-2,5-difluorophenyl]acetate?
The IUPAC name of methyl 2-[4-[[6-[(4-cyano-2-fluorophenyl)methoxy]-2-pyridinyl]oxy]-2,5-difluorophenyl]acetate (CID 175522713) is methyl 2-[4-[[6-[(4-cyano-2-fluorophenyl)methoxy]-2-pyridinyl]oxy]-2,5-difluorophenyl]acetate.
What is the SMILES notation for methyl 2-[4-[[6-[(4-cyano-2-fluorophenyl)methoxy]-2-pyridinyl]oxy]-2,5-difluorophenyl]acetate?
The canonical SMILES for methyl 2-[4-[[6-[(4-cyano-2-fluorophenyl)methoxy]-2-pyridinyl]oxy]-2,5-difluorophenyl]acetate is COC(=O)Cc1cc(F)c(Oc2cccc(OCc3ccc(C#N)cc3F)n2)cc1F.
What is the InChIKey of methyl 2-[4-[[6-[(4-cyano-2-fluorophenyl)methoxy]-2-pyridinyl]oxy]-2,5-difluorophenyl]acetate?
The InChIKey is KGENEWJHPZUHAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F3N2O4/c1-29-22(28)9-15-8-18(25)19(10-17(15)24)31-21-4-2-3-20(27-21)30-12-14-6-5-13(11-26)7-16(14)23/h2-8,10H,9,12H2,1H3.
What are the key properties of methyl 2-[4-[[6-[(4-cyano-2-fluorophenyl)methoxy]-2-pyridinyl]oxy]-2,5-difluorophenyl]acetate?
methyl 2-[4-[[6-[(4-cyano-2-fluorophenyl)methoxy]-2-pyridinyl]oxy]-2,5-difluorophenyl]acetate has a molecular weight of 428.37 g/mol, XLogP of 4.46, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-[[6-[(4-cyano-2-fluorophenyl)methoxy]-2-pyridinyl]oxy]-2,5-difluorophenyl]acetate is sourced from PubChem (CID 175522713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).