C19H20F2N2O5 — CID 175533308
methyl 2-amino-5-[3-(3-carbamoyl-2,6-difluorophenyl)propoxy]-4-methoxybenzoate (PubChem CID 175533308) has the molecular formula C19H20F2N2O5 and a molecular weight of 394.37 g/mol. Its IUPAC name is methyl 2-amino-5-[3-(3-carbamoyl-2,6-difluorophenyl)propoxy]-4-methoxybenzoate.
| Compound Name | methyl 2-amino-5-[3-(3-carbamoyl-2,6-difluorophenyl)propoxy]-4-methoxybenzoate |
|---|---|
| PubChem CID | 175533308 |
| Molecular Formula | C19H20F2N2O5 |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | methyl 2-amino-5-[3-(3-carbamoyl-2,6-difluorophenyl)propoxy]-4-methoxybenzoate |
| SMILES | COC(=O)c1cc(OCCCc2c(F)ccc(C(N)=O)c2F)c(OC)cc1N |
| InChI | InChI=1S/C19H20F2N2O5/c1-26-15-9-14(22)12(19(25)27-2)8-16(15)28-7-3-4-10-13(20)6-5-11(17(10)21)18(23)24/h5-6,8-9H,3-4,7,22H2,1-2H3,(H2,23,24) |
| InChIKey | BQEIKUJEZTWKAU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|