C10H11BF2N2O3 — CID 175534294
[2-(1-carbamoyl-3,3-difluorocyclobutyl)-4-pyridinyl]boronic acid (PubChem CID 175534294) has the molecular formula C10H11BF2N2O3 and a molecular weight of 256.02 g/mol. Its IUPAC name is [2-(1-carbamoyl-3,3-difluorocyclobutyl)-4-pyridinyl]boronic acid.
| Compound Name | [2-(1-carbamoyl-3,3-difluorocyclobutyl)-4-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 175534294 |
| Molecular Formula | C10H11BF2N2O3 |
| Molecular Weight | 256.02 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | [2-(1-carbamoyl-3,3-difluorocyclobutyl)-4-pyridinyl]boronic acid |
| SMILES | NC(=O)C1(c2cc(B(O)O)ccn2)CC(F)(F)C1 |
| InChI | InChI=1S/C10H11BF2N2O3/c12-10(13)4-9(5-10,8(14)16)7-3-6(11(17)18)1-2-15-7/h1-3,17-18H,4-5H2,(H2,14,16) |
| InChIKey | YJPVEAYLXBQYAH-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.02 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|