C12H12F3N2O3S- — CID 123221423
4-(1-carbamoyl-3,3-difluorocyclobutyl)-2-fluoro-1-[(sulfinatoamino)methyl]benzene (PubChem CID 123221423) has the molecular formula C12H12F3N2O3S- and a molecular weight of 321.30 g/mol. Its IUPAC name is 4-(1-carbamoyl-3,3-difluorocyclobutyl)-2-fluoro-1-[(sulfinatoamino)methyl]benzene.
| Compound Name | 4-(1-carbamoyl-3,3-difluorocyclobutyl)-2-fluoro-1-[(sulfinatoamino)methyl]benzene |
|---|---|
| PubChem CID | 123221423 |
| Molecular Formula | C12H12F3N2O3S- |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 4-(1-carbamoyl-3,3-difluorocyclobutyl)-2-fluoro-1-[(sulfinatoamino)methyl]benzene |
| SMILES | NC(=O)C1(c2ccc(CNS(=O)[O-])c(F)c2)CC(F)(F)C1 |
| InChI | InChI=1S/C12H13F3N2O3S/c13-9-3-8(2-1-7(9)4-17-21(19)20)11(10(16)18)5-12(14,15)6-11/h1-3,17H,4-6H2,(H2,16,18)(H,19,20)/p-1 |
| InChIKey | PJGVURVWROSVAO-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|