C16H20F2N2O — CID 123710256
3-fluoro-3-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]cyclobutane-1-carboxamide (PubChem CID 123710256) has the molecular formula C16H20F2N2O and a molecular weight of 294.34 g/mol. Its IUPAC name is 3-fluoro-3-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]cyclobutane-1-carboxamide.
| Compound Name | 3-fluoro-3-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 123710256 |
| Molecular Formula | C16H20F2N2O |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 3-fluoro-3-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]cyclobutane-1-carboxamide |
| SMILES | NC(=O)C1CC(F)(c2ccc(CN3CCCC3)c(F)c2)C1 |
| InChI | InChI=1S/C16H20F2N2O/c17-14-7-13(16(18)8-12(9-16)15(19)21)4-3-11(14)10-20-5-1-2-6-20/h3-4,7,12H,1-2,5-6,8-10H2,(H2,19,21) |
| InChIKey | WWPWMVWYEQNZLW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |