C16H19F2NO2 — CID 141170402
3-fluoro-3-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]cyclobutane-1-carboxylic acid (PubChem CID 141170402) has the molecular formula C16H19F2NO2 and a molecular weight of 295.33 g/mol. Its IUPAC name is 3-fluoro-3-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]cyclobutane-1-carboxylic acid.
| Compound Name | 3-fluoro-3-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 141170402 |
| Molecular Formula | C16H19F2NO2 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 3-fluoro-3-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CC(F)(c2ccc(CN3CCCC3)c(F)c2)C1 |
| InChI | InChI=1S/C16H19F2NO2/c17-14-7-13(16(18)8-12(9-16)15(20)21)4-3-11(14)10-19-5-1-2-6-19/h3-4,7,12H,1-2,5-6,8-10H2,(H,20,21) |
| InChIKey | OWHHYDYEGJCXKV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |