C12H19N2O2S- — CID 70968125
4-[(1R)-1-aminopropyl]-2-ethyl-1-[(sulfinatoamino)methyl]benzene (PubChem CID 70968125) has the molecular formula C12H19N2O2S- and a molecular weight of 255.36 g/mol. Its IUPAC name is 4-[(1R)-1-aminopropyl]-2-ethyl-1-[(sulfinatoamino)methyl]benzene.
| Compound Name | 4-[(1R)-1-aminopropyl]-2-ethyl-1-[(sulfinatoamino)methyl]benzene |
|---|---|
| PubChem CID | 70968125 |
| Molecular Formula | C12H19N2O2S- |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 4-[(1R)-1-aminopropyl]-2-ethyl-1-[(sulfinatoamino)methyl]benzene |
| SMILES | CCc1cc([C@H](N)CC)ccc1CNS(=O)[O-] |
| InChI | InChI=1S/C12H20N2O2S/c1-3-9-7-10(12(13)4-2)5-6-11(9)8-14-17(15)16/h5-7,12,14H,3-4,8,13H2,1-2H3,(H,15,16)/p-1/t12-/m1/s1 |
| InChIKey | YMRYSRJZJQSBSO-GFCCVEGCSA-M |
| XLogP | 1.54 |
| TPSA | 78.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|