C16H26N2O — CID 113319108
4-amino-4-(3,4-diethylphenyl)-2,2-dimethylbutanamide (PubChem CID 113319108) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 4-amino-4-(3,4-diethylphenyl)-2,2-dimethylbutanamide.
| Compound Name | 4-amino-4-(3,4-diethylphenyl)-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 113319108 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 4-amino-4-(3,4-diethylphenyl)-2,2-dimethylbutanamide |
| SMILES | CCc1ccc(C(N)CC(C)(C)C(N)=O)cc1CC |
| InChI | InChI=1S/C16H26N2O/c1-5-11-7-8-13(9-12(11)6-2)14(17)10-16(3,4)15(18)19/h7-9,14H,5-6,10,17H2,1-4H3,(H2,18,19) |
| InChIKey | LPBLBWDSYSACBG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |