C23H38O2 — CID 144690622
1-(3,4-diethylphenyl)ethyl 2-tert-butyl-4,4-dimethylpentanoate (PubChem CID 144690622) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is 1-(3,4-diethylphenyl)ethyl 2-tert-butyl-4,4-dimethylpentanoate.
| Compound Name | 1-(3,4-diethylphenyl)ethyl 2-tert-butyl-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 144690622 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | 1-(3,4-diethylphenyl)ethyl 2-tert-butyl-4,4-dimethylpentanoate |
| SMILES | CCc1ccc(C(C)OC(=O)C(CC(C)(C)C)C(C)(C)C)cc1CC |
| InChI | InChI=1S/C23H38O2/c1-10-17-12-13-19(14-18(17)11-2)16(3)25-21(24)20(23(7,8)9)15-22(4,5)6/h12-14,16,20H,10-11,15H2,1-9H3 |
| InChIKey | QBPNHIRDLIGIGS-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |