C14H22O3S — CID 104521255
1-(3,4-diethylphenyl)-2-methylsulfonylpropan-1-ol (PubChem CID 104521255) has the molecular formula C14H22O3S and a molecular weight of 270.39 g/mol. Its IUPAC name is 1-(3,4-diethylphenyl)-2-methylsulfonylpropan-1-ol.
| Compound Name | 1-(3,4-diethylphenyl)-2-methylsulfonylpropan-1-ol |
|---|---|
| PubChem CID | 104521255 |
| Molecular Formula | C14H22O3S |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-(3,4-diethylphenyl)-2-methylsulfonylpropan-1-ol |
| SMILES | CCc1ccc(C(O)C(C)S(C)(=O)=O)cc1CC |
| InChI | InChI=1S/C14H22O3S/c1-5-11-7-8-13(9-12(11)6-2)14(15)10(3)18(4,16)17/h7-10,14-15H,5-6H2,1-4H3 |
| InChIKey | PABRCZWJGFBPMM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |