C13H20O3S — CID 113319164
1-(3,4-diethylphenyl)-2-methylsulfonylethanol (PubChem CID 113319164) has the molecular formula C13H20O3S and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-(3,4-diethylphenyl)-2-methylsulfonylethanol.
| Compound Name | 1-(3,4-diethylphenyl)-2-methylsulfonylethanol |
|---|---|
| PubChem CID | 113319164 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1-(3,4-diethylphenyl)-2-methylsulfonylethanol |
| SMILES | CCc1ccc(C(O)CS(C)(=O)=O)cc1CC |
| InChI | InChI=1S/C13H20O3S/c1-4-10-6-7-12(8-11(10)5-2)13(14)9-17(3,15)16/h6-8,13-14H,4-5,9H2,1-3H3 |
| InChIKey | AHJXLYTUDLUEFV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |