C12H18O3S — CID 104521030
1-(3,4-dimethylphenyl)-2-methylsulfonylpropan-1-ol (PubChem CID 104521030) has the molecular formula C12H18O3S and a molecular weight of 242.34 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-methylsulfonylpropan-1-ol.
| Compound Name | 1-(3,4-dimethylphenyl)-2-methylsulfonylpropan-1-ol |
|---|---|
| PubChem CID | 104521030 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-methylsulfonylpropan-1-ol |
| SMILES | Cc1ccc(C(O)C(C)S(C)(=O)=O)cc1C |
| InChI | InChI=1S/C12H18O3S/c1-8-5-6-11(7-9(8)2)12(13)10(3)16(4,14)15/h5-7,10,12-13H,1-4H3 |
| InChIKey | RUEFITVCXOSIGM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |