C23H40O2 — CID 144690858
4-(3-tert-butyl-5,5-dimethylhexan-2-yl)-1,2-diethylbenzene;formic acid (PubChem CID 144690858) has the molecular formula C23H40O2 and a molecular weight of 348.57 g/mol. Its IUPAC name is 4-(3-tert-butyl-5,5-dimethylhexan-2-yl)-1,2-diethylbenzene;formic acid.
| Compound Name | 4-(3-tert-butyl-5,5-dimethylhexan-2-yl)-1,2-diethylbenzene;formic acid |
|---|---|
| PubChem CID | 144690858 |
| Molecular Formula | C23H40O2 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.30 |
| IUPAC Name | 4-(3-tert-butyl-5,5-dimethylhexan-2-yl)-1,2-diethylbenzene;formic acid |
| SMILES | CCc1ccc(C(C)C(CC(C)(C)C)C(C)(C)C)cc1CC.O=CO |
| InChI | InChI=1S/C22H38.CH2O2/c1-10-17-12-13-19(14-18(17)11-2)16(3)20(22(7,8)9)15-21(4,5)6;2-1-3/h12-14,16,20H,10-11,15H2,1-9H3;1H,(H,2,3) |
| InChIKey | QGXACYZNSHUHMF-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|