C14H17F3N2O4 — CID 175535897
[4-methyl-3-(morpholin-4-ylmethyl)-5-(trifluoromethoxy)phenyl] carbamate (PubChem CID 175535897) has the molecular formula C14H17F3N2O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is [4-methyl-3-(morpholin-4-ylmethyl)-5-(trifluoromethoxy)phenyl] carbamate.
| Compound Name | [4-methyl-3-(morpholin-4-ylmethyl)-5-(trifluoromethoxy)phenyl] carbamate |
|---|---|
| PubChem CID | 175535897 |
| Molecular Formula | C14H17F3N2O4 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | [4-methyl-3-(morpholin-4-ylmethyl)-5-(trifluoromethoxy)phenyl] carbamate |
| SMILES | Cc1c(CN2CCOCC2)cc(OC(N)=O)cc1OC(F)(F)F |
| InChI | InChI=1S/C14H17F3N2O4/c1-9-10(8-19-2-4-21-5-3-19)6-11(22-13(18)20)7-12(9)23-14(15,16)17/h6-7H,2-5,8H2,1H3,(H2,18,20) |
| InChIKey | IBOYGLJBRLKFLR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |