C12H15N3O3 — CID 175536783
[(E)-1-(methylamino)-1-oxo-5-pyridin-3-ylpent-4-en-2-yl]carbamic acid (PubChem CID 175536783) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is [(E)-1-(methylamino)-1-oxo-5-pyridin-3-ylpent-4-en-2-yl]carbamic acid.
| Compound Name | [(E)-1-(methylamino)-1-oxo-5-pyridin-3-ylpent-4-en-2-yl]carbamic acid |
|---|---|
| PubChem CID | 175536783 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | [(E)-1-(methylamino)-1-oxo-5-pyridin-3-ylpent-4-en-2-yl]carbamic acid |
| SMILES | CNC(=O)C(C/C=C/c1cccnc1)NC(=O)O |
| InChI | InChI=1S/C12H15N3O3/c1-13-11(16)10(15-12(17)18)6-2-4-9-5-3-7-14-8-9/h2-5,7-8,10,15H,6H2,1H3,(H,13,16)(H,17,18)/b4-2+ |
| InChIKey | VZTVOTPMCSTOCS-DUXPYHPUSA-N |
| XLogP | 0.87 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |