C22H27ClO6 — CID 175539169
(8S,9S,10S,11S,13R,14S,17S)-13-formyl-11-hydroxy-17-(2-hydroxyacetyl)-10-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1-carbonyl chloride (PubChem CID 175539169) has the molecular formula C22H27ClO6 and a molecular weight of 422.91 g/mol. Its IUPAC name is (8S,9S,10S,11S,13R,14S,17S)-13-formyl-11-hydroxy-17-(2-hydroxyacetyl)-10-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1-carbonyl chloride.
| Compound Name | (8S,9S,10S,11S,13R,14S,17S)-13-formyl-11-hydroxy-17-(2-hydroxyacetyl)-10-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1-carbonyl chloride |
|---|---|
| PubChem CID | 175539169 |
| Molecular Formula | C22H27ClO6 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (8S,9S,10S,11S,13R,14S,17S)-13-formyl-11-hydroxy-17-(2-hydroxyacetyl)-10-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1-carbonyl chloride |
| SMILES | C[C@@]12C(=CC(=O)CC1C(=O)Cl)CC[C@@H]1[C@@H]2[C@@H](O)C[C@]2(C=O)[C@@H](C(=O)CO)CC[C@@H]12 |
| InChI | InChI=1S/C22H27ClO6/c1-21-11(6-12(26)7-16(21)20(23)29)2-3-13-14-4-5-15(18(28)9-24)22(14,10-25)8-17(27)19(13)21/h6,10,13-17,19,24,27H,2-5,7-9H2,1H3/t13-,14-,15+,16?,17-,19+,21+,22+/m0/s1 |
| InChIKey | ITUASNUHNLSEFH-DTABTNNISA-N |
| XLogP | 1.84 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|