C8H14F3NO3 — CID 175539539
methyl (2S)-2-amino-3,4,7-trifluoro-6-hydroxyheptanoate (PubChem CID 175539539) has the molecular formula C8H14F3NO3 and a molecular weight of 229.20 g/mol. Its IUPAC name is methyl (2S)-2-amino-3,4,7-trifluoro-6-hydroxyheptanoate.
| Compound Name | methyl (2S)-2-amino-3,4,7-trifluoro-6-hydroxyheptanoate |
|---|---|
| PubChem CID | 175539539 |
| Molecular Formula | C8H14F3NO3 |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | methyl (2S)-2-amino-3,4,7-trifluoro-6-hydroxyheptanoate |
| SMILES | COC(=O)[C@H](N)C(F)C(F)CC(O)CF |
| InChI | InChI=1S/C8H14F3NO3/c1-15-8(14)7(12)6(11)5(10)2-4(13)3-9/h4-7,13H,2-3,12H2,1H3/t4?,5?,6?,7-/m1/s1 |
| InChIKey | HSGDZFDEZSCMAK-MXFXWPKCSA-N |
| XLogP | -0.12 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |