C31H25F3N2O — CID 175540787
N-[(1R)-1-(azetidin-3-yl)ethyl]-5-[4-(trifluoromethyl)phenyl]tetracene-2-carboxamide (PubChem CID 175540787) has the molecular formula C31H25F3N2O and a molecular weight of 498.55 g/mol. Its IUPAC name is N-[(1R)-1-(azetidin-3-yl)ethyl]-5-[4-(trifluoromethyl)phenyl]tetracene-2-carboxamide.
| Compound Name | N-[(1R)-1-(azetidin-3-yl)ethyl]-5-[4-(trifluoromethyl)phenyl]tetracene-2-carboxamide |
|---|---|
| PubChem CID | 175540787 |
| Molecular Formula | C31H25F3N2O |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | N-[(1R)-1-(azetidin-3-yl)ethyl]-5-[4-(trifluoromethyl)phenyl]tetracene-2-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(-c3ccc(C(F)(F)F)cc3)c3cc4ccccc4cc3cc2c1)C1CNC1 |
| InChI | InChI=1S/C31H25F3N2O/c1-18(25-16-35-17-25)36-30(37)22-8-11-27-23(13-22)14-24-12-20-4-2-3-5-21(20)15-28(24)29(27)19-6-9-26(10-7-19)31(32,33)34/h2-15,18,25,35H,16-17H2,1H3,(H,36,37)/t18-/m1/s1 |
| InChIKey | MSLNAPCVPWPFTQ-GOSISDBHSA-N |
| XLogP | 7.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|