C26H21F3N2O2 — CID 175159865
7-methoxy-N-(1-pyridin-2-ylethyl)-5-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide (PubChem CID 175159865) has the molecular formula C26H21F3N2O2 and a molecular weight of 450.46 g/mol. Its IUPAC name is 7-methoxy-N-(1-pyridin-2-ylethyl)-5-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide.
| Compound Name | 7-methoxy-N-(1-pyridin-2-ylethyl)-5-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 175159865 |
| Molecular Formula | C26H21F3N2O2 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 7-methoxy-N-(1-pyridin-2-ylethyl)-5-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide |
| SMILES | COc1cc(-c2ccc(C(F)(F)F)cc2)c2ccc(C(=O)NC(C)c3ccccn3)cc2c1 |
| InChI | InChI=1S/C26H21F3N2O2/c1-16(24-5-3-4-12-30-24)31-25(32)18-8-11-22-19(13-18)14-21(33-2)15-23(22)17-6-9-20(10-7-17)26(27,28)29/h3-16H,1-2H3,(H,31,32) |
| InChIKey | KJBNSFSWLWFEJY-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |