C33H29F3N4O5S — CID 10283066
ethanesulfonic acid;N-(1-pyridin-2-ylethyl)-7-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]quinoline-3-carboxamide (PubChem CID 10283066) has the molecular formula C33H29F3N4O5S and a molecular weight of 650.68 g/mol. Its IUPAC name is ethanesulfonic acid;N-(1-pyridin-2-ylethyl)-7-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]quinoline-3-carboxamide.
| Compound Name | ethanesulfonic acid;N-(1-pyridin-2-ylethyl)-7-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 10283066 |
| Molecular Formula | C33H29F3N4O5S |
| Molecular Weight | 650.68 g/mol |
| Exact Mass | 650.18 |
| IUPAC Name | ethanesulfonic acid;N-(1-pyridin-2-ylethyl)-7-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]quinoline-3-carboxamide |
| SMILES | CC(NC(=O)c1cnc2cc(NC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)ccc2c1)c1ccccn1.CCS(=O)(=O)O |
| InChI | InChI=1S/C31H23F3N4O2.C2H6O3S/c1-19(27-8-4-5-15-35-27)37-29(39)22-16-21-11-14-24(17-28(21)36-18-22)38-30(40)26-7-3-2-6-25(26)20-9-12-23(13-10-20)31(32,33)34;1-2-6(3,4)5/h2-19H,1H3,(H,37,39)(H,38,40);2H2,1H3,(H,3,4,5) |
| InChIKey | LGPPRELVNUXBPO-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 138.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.68 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|