C31H26N4O2 — CID 10184681
7-[(2-phenylbenzoyl)amino]-N-(1-pyridin-2-ylpropyl)quinoline-3-carboxamide (PubChem CID 10184681) has the molecular formula C31H26N4O2 and a molecular weight of 486.58 g/mol. Its IUPAC name is 7-[(2-phenylbenzoyl)amino]-N-(1-pyridin-2-ylpropyl)quinoline-3-carboxamide.
| Compound Name | 7-[(2-phenylbenzoyl)amino]-N-(1-pyridin-2-ylpropyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 10184681 |
| Molecular Formula | C31H26N4O2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 7-[(2-phenylbenzoyl)amino]-N-(1-pyridin-2-ylpropyl)quinoline-3-carboxamide |
| SMILES | CCC(NC(=O)c1cnc2cc(NC(=O)c3ccccc3-c3ccccc3)ccc2c1)c1ccccn1 |
| InChI | InChI=1S/C31H26N4O2/c1-2-27(28-14-8-9-17-32-28)35-30(36)23-18-22-15-16-24(19-29(22)33-20-23)34-31(37)26-13-7-6-12-25(26)21-10-4-3-5-11-21/h3-20,27H,2H2,1H3,(H,34,37)(H,35,36) |
| InChIKey | OJTRZXOAXYDOHA-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |