C32H34N4O3 — CID 90857782
7-[[2-(cyclohexylmethoxy)benzoyl]amino]-N-(1-pyridin-2-ylpropyl)quinoline-3-carboxamide (PubChem CID 90857782) has the molecular formula C32H34N4O3 and a molecular weight of 522.65 g/mol. Its IUPAC name is 7-[[2-(cyclohexylmethoxy)benzoyl]amino]-N-(1-pyridin-2-ylpropyl)quinoline-3-carboxamide.
| Compound Name | 7-[[2-(cyclohexylmethoxy)benzoyl]amino]-N-(1-pyridin-2-ylpropyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 90857782 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 7-[[2-(cyclohexylmethoxy)benzoyl]amino]-N-(1-pyridin-2-ylpropyl)quinoline-3-carboxamide |
| SMILES | CCC(NC(=O)c1cnc2cc(NC(=O)c3ccccc3OCC3CCCCC3)ccc2c1)c1ccccn1 |
| InChI | InChI=1S/C32H34N4O3/c1-2-27(28-13-8-9-17-33-28)36-31(37)24-18-23-15-16-25(19-29(23)34-20-24)35-32(38)26-12-6-7-14-30(26)39-21-22-10-4-3-5-11-22/h6-9,12-20,22,27H,2-5,10-11,21H2,1H3,(H,35,38)(H,36,37) |
| InChIKey | CSRDIYXOVFOLLG-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |