C23H24N4O2 — CID 47090333
N-[3-(cyclohexylmethoxy)-2-pyridinyl]-2-phenylpyrimidine-5-carboxamide (PubChem CID 47090333) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[3-(cyclohexylmethoxy)-2-pyridinyl]-2-phenylpyrimidine-5-carboxamide.
| Compound Name | N-[3-(cyclohexylmethoxy)-2-pyridinyl]-2-phenylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 47090333 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-[3-(cyclohexylmethoxy)-2-pyridinyl]-2-phenylpyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ncccc1OCC1CCCCC1)c1cnc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C23H24N4O2/c28-23(19-14-25-21(26-15-19)18-10-5-2-6-11-18)27-22-20(12-7-13-24-22)29-16-17-8-3-1-4-9-17/h2,5-7,10-15,17H,1,3-4,8-9,16H2,(H,24,27,28) |
| InChIKey | UBWOCUYJUOAGBM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |