C25H20F3N3O3 — CID 155213963
6-methoxy-N-(1-pyridin-2-ylethyl)-8-[4-(trifluoromethyl)phenoxy]quinoline-3-carboxamide (PubChem CID 155213963) has the molecular formula C25H20F3N3O3 and a molecular weight of 467.45 g/mol. Its IUPAC name is 6-methoxy-N-(1-pyridin-2-ylethyl)-8-[4-(trifluoromethyl)phenoxy]quinoline-3-carboxamide.
| Compound Name | 6-methoxy-N-(1-pyridin-2-ylethyl)-8-[4-(trifluoromethyl)phenoxy]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 155213963 |
| Molecular Formula | C25H20F3N3O3 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 6-methoxy-N-(1-pyridin-2-ylethyl)-8-[4-(trifluoromethyl)phenoxy]quinoline-3-carboxamide |
| SMILES | COc1cc(Oc2ccc(C(F)(F)F)cc2)c2ncc(C(=O)NC(C)c3ccccn3)cc2c1 |
| InChI | InChI=1S/C25H20F3N3O3/c1-15(21-5-3-4-10-29-21)31-24(32)17-11-16-12-20(33-2)13-22(23(16)30-14-17)34-19-8-6-18(7-9-19)25(26,27)28/h3-15H,1-2H3,(H,31,32) |
| InChIKey | LDSRKGPMYKOSKO-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |