C14H24 — CID 175542706
1,4-di(butylidene)cyclohexane (PubChem CID 175542706) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 1,4-di(butylidene)cyclohexane.
| Compound Name | 1,4-di(butylidene)cyclohexane |
|---|---|
| PubChem CID | 175542706 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 1,4-di(butylidene)cyclohexane |
| SMILES | CCCC=C1CCC(=CCCC)CC1 |
| InChI | InChI=1S/C14H24/c1-3-5-7-13-9-11-14(12-10-13)8-6-4-2/h7-8H,3-6,9-12H2,1-2H3/b13-7-,14-8+ |
| InChIKey | CZQBNVSVSYSXDG-MFUUIURDSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|