C26H24FN5O2 — CID 175544267
N-[[2-[6-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)-3-phenylphenyl]-1,3-benzoxazol-5-yl]methyl]-2-methoxyethanamine (PubChem CID 175544267) has the molecular formula C26H24FN5O2 and a molecular weight of 457.51 g/mol. Its IUPAC name is N-[[2-[6-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)-3-phenylphenyl]-1,3-benzoxazol-5-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[2-[6-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)-3-phenylphenyl]-1,3-benzoxazol-5-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 175544267 |
| Molecular Formula | C26H24FN5O2 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | N-[[2-[6-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)-3-phenylphenyl]-1,3-benzoxazol-5-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1ccc2oc(-c3c(F)ccc(-c4ccccc4)c3-c3nncn3C)nc2c1 |
| InChI | InChI=1S/C26H24FN5O2/c1-32-16-29-31-25(32)23-19(18-6-4-3-5-7-18)9-10-20(27)24(23)26-30-21-14-17(8-11-22(21)34-26)15-28-12-13-33-2/h3-11,14,16,28H,12-13,15H2,1-2H3 |
| InChIKey | HZIAUNFILSJZEL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|