C17H24BrNO2SSi — CID 175544968
[4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane (PubChem CID 175544968) has the molecular formula C17H24BrNO2SSi and a molecular weight of 414.44 g/mol. Its IUPAC name is [4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 175544968 |
| Molecular Formula | C17H24BrNO2SSi |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | [4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(Br)c(OCc2cscn2)c1 |
| InChI | InChI=1S/C17H24BrNO2SSi/c1-17(2,3)23(4,5)21-9-13-6-7-15(18)16(8-13)20-10-14-11-22-12-19-14/h6-8,11-12H,9-10H2,1-5H3 |
| InChIKey | AWOAHCLCHIDUMC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|