About [4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane
[4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane (PubChem CID 175544968) has the molecular formula C17H24BrNO2SSi
and a molecular weight of 414.44 g/mol. Its IUPAC name is [4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | [4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane |
| PubChem CID | 175544968 |
| Molecular Formula | C17H24BrNO2SSi |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | [4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(Br)c(OCc2cscn2)c1 |
| InChI | InChI=1S/C17H24BrNO2SSi/c1-17(2,3)23(4,5)21-9-13-6-7-15(18)16(8-13)20-10-14-11-22-12-19-14/h6-8,11-12H,9-10H2,1-5H3 |
| InChIKey | AWOAHCLCHIDUMC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane?
The IUPAC name of [4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane (CID 175544968) is [4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane.
What is the SMILES notation for [4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane?
The canonical SMILES for [4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane is CC(C)(C)[Si](C)(C)OCc1ccc(Br)c(OCc2cscn2)c1.
What is the InChIKey of [4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane?
The InChIKey is AWOAHCLCHIDUMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24BrNO2SSi/c1-17(2,3)23(4,5)21-9-13-6-7-15(18)16(8-13)20-10-14-11-22-12-19-14/h6-8,11-12H,9-10H2,1-5H3.
What are the key properties of [4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane?
[4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane has a molecular weight of 414.44 g/mol, XLogP of 6.01, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-bromo-3-(1,3-thiazol-4-ylmethoxy)phenyl]methoxy-tert-butyl-dimethylsilane is sourced from PubChem (CID 175544968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).