C15H24O6 — CID 175547756
2-hydroxybutyl 6-hydroxy-2-methyl-3-prop-2-enoyloxyhept-2-enoate (PubChem CID 175547756) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-hydroxybutyl 6-hydroxy-2-methyl-3-prop-2-enoyloxyhept-2-enoate.
| Compound Name | 2-hydroxybutyl 6-hydroxy-2-methyl-3-prop-2-enoyloxyhept-2-enoate |
|---|---|
| PubChem CID | 175547756 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-hydroxybutyl 6-hydroxy-2-methyl-3-prop-2-enoyloxyhept-2-enoate |
| SMILES | C=CC(=O)OC(CCC(C)O)=C(C)C(=O)OCC(O)CC |
| InChI | InChI=1S/C15H24O6/c1-5-12(17)9-20-15(19)11(4)13(8-7-10(3)16)21-14(18)6-2/h6,10,12,16-17H,2,5,7-9H2,1,3-4H3 |
| InChIKey | YNHSJKGBGPPZCN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|