C14H28N2O5 — CID 175547813
tert-butyl (3S)-3-amino-5-(2-methoxyethoxymethoxy)piperidine-1-carboxylate (PubChem CID 175547813) has the molecular formula C14H28N2O5 and a molecular weight of 304.39 g/mol. Its IUPAC name is tert-butyl (3S)-3-amino-5-(2-methoxyethoxymethoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-amino-5-(2-methoxyethoxymethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175547813 |
| Molecular Formula | C14H28N2O5 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | tert-butyl (3S)-3-amino-5-(2-methoxyethoxymethoxy)piperidine-1-carboxylate |
| SMILES | COCCOCOC1C[C@H](N)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H28N2O5/c1-14(2,3)21-13(17)16-8-11(15)7-12(9-16)20-10-19-6-5-18-4/h11-12H,5-10,15H2,1-4H3/t11-,12?/m0/s1 |
| InChIKey | IMQDJTFQCRDDCH-PXYINDEMSA-N |
| XLogP | 0.96 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|