C21H18BrN3O3 — CID 175550767
ethyl 2-[2-[(4-bromophenyl)methoxy]-3-cyanophenyl]-5-methyl-1H-imidazole-4-carboxylate (PubChem CID 175550767) has the molecular formula C21H18BrN3O3 and a molecular weight of 440.30 g/mol. Its IUPAC name is ethyl 2-[2-[(4-bromophenyl)methoxy]-3-cyanophenyl]-5-methyl-1H-imidazole-4-carboxylate.
| Compound Name | ethyl 2-[2-[(4-bromophenyl)methoxy]-3-cyanophenyl]-5-methyl-1H-imidazole-4-carboxylate |
|---|---|
| PubChem CID | 175550767 |
| Molecular Formula | C21H18BrN3O3 |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | ethyl 2-[2-[(4-bromophenyl)methoxy]-3-cyanophenyl]-5-methyl-1H-imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cccc(C#N)c2OCc2ccc(Br)cc2)[nH]c1C |
| InChI | InChI=1S/C21H18BrN3O3/c1-3-27-21(26)18-13(2)24-20(25-18)17-6-4-5-15(11-23)19(17)28-12-14-7-9-16(22)10-8-14/h4-10H,3,12H2,1-2H3,(H,24,25) |
| InChIKey | FKRVAFHLCWVYRA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |