About lithium;difluoroborinate;methanedisulfonic acid
lithium;difluoroborinate;methanedisulfonic acid (PubChem CID 175553813) has the molecular formula CH4BF2LiO7S2
and a molecular weight of 247.92 g/mol. Its IUPAC name is lithium;difluoroborinate;methanedisulfonic acid.
Molecular Properties
| Compound Name | lithium;difluoroborinate;methanedisulfonic acid |
| PubChem CID | 175553813 |
| Molecular Formula | CH4BF2LiO7S2 |
| Molecular Weight | 247.92 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | lithium;difluoroborinate;methanedisulfonic acid |
| SMILES | O=S(=O)(O)CS(=O)(=O)O.[Li+].[O-]B(F)F |
| InChI | InChI=1S/CH4O6S2.BF2O.Li/c2-8(3,4)1-9(5,6)7;2-1(3)4;/h1H2,(H,2,3,4)(H,5,6,7);;/q;-1;+1 |
| InChIKey | CLSYZPANLWBCOP-UHFFFAOYSA-N |
| XLogP | -5.01 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.92 |
| LogP ≤ 5 | -5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze lithium;difluoroborinate;methanedisulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;difluoroborinate;methanedisulfonic acid?
The IUPAC name of lithium;difluoroborinate;methanedisulfonic acid (CID 175553813) is lithium;difluoroborinate;methanedisulfonic acid.
What is the SMILES notation for lithium;difluoroborinate;methanedisulfonic acid?
The canonical SMILES for lithium;difluoroborinate;methanedisulfonic acid is O=S(=O)(O)CS(=O)(=O)O.[Li+].[O-]B(F)F.
What is the InChIKey of lithium;difluoroborinate;methanedisulfonic acid?
The InChIKey is CLSYZPANLWBCOP-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4O6S2.BF2O.Li/c2-8(3,4)1-9(5,6)7;2-1(3)4;/h1H2,(H,2,3,4)(H,5,6,7);;/q;-1;+1.
What are the key properties of lithium;difluoroborinate;methanedisulfonic acid?
lithium;difluoroborinate;methanedisulfonic acid has a molecular weight of 247.92 g/mol, XLogP of -5.01, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;difluoroborinate;methanedisulfonic acid is sourced from PubChem (CID 175553813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).